C24H30N4O2 — CID 11509710
3,8-dimethyl-2-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]pyrido[4,3-d]pyrimidin-4-one (PubChem CID 11509710) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 3,8-dimethyl-2-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 3,8-dimethyl-2-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 11509710 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 3,8-dimethyl-2-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]pyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1cncc2c(=O)n(C)c(-c3ccc(OCCCN4CCC[C@H](C)C4)cc3)nc12 |
| InChI | InChI=1S/C24H30N4O2/c1-17-6-4-11-28(16-17)12-5-13-30-20-9-7-19(8-10-20)23-26-22-18(2)14-25-15-21(22)24(29)27(23)3/h7-10,14-15,17H,4-6,11-13,16H2,1-3H3/t17-/m0/s1 |
| InChIKey | BLOWFUFUMSXQHM-KRWDZBQOSA-N |
| XLogP | 3.80 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|