C30H23Cl2N3O2 — CID 141121313
4-[[2-[[4-(3-aminophenyl)phenyl]methyl]-4-(2,4-dichlorophenyl)imidazol-1-yl]methyl]benzoic acid (PubChem CID 141121313) has the molecular formula C30H23Cl2N3O2 and a molecular weight of 528.44 g/mol. Its IUPAC name is 4-[[2-[[4-(3-aminophenyl)phenyl]methyl]-4-(2,4-dichlorophenyl)imidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[2-[[4-(3-aminophenyl)phenyl]methyl]-4-(2,4-dichlorophenyl)imidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 141121313 |
| Molecular Formula | C30H23Cl2N3O2 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 4-[[2-[[4-(3-aminophenyl)phenyl]methyl]-4-(2,4-dichlorophenyl)imidazol-1-yl]methyl]benzoic acid |
| SMILES | Nc1cccc(-c2ccc(Cc3nc(-c4ccc(Cl)cc4Cl)cn3Cc3ccc(C(=O)O)cc3)cc2)c1 |
| InChI | InChI=1S/C30H23Cl2N3O2/c31-24-12-13-26(27(32)16-24)28-18-35(17-20-6-10-22(11-7-20)30(36)37)29(34-28)14-19-4-8-21(9-5-19)23-2-1-3-25(33)15-23/h1-13,15-16,18H,14,17,33H2,(H,36,37) |
| InChIKey | OPQLDCWGDHHVAP-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|