C32H24Cl2F3N3O5S — CID 67118145
3-amino-4-[4-[4-[[4-(2,4-dichlorophenyl)-1-ethylimidazol-2-yl]methyl]phenyl]phenoxy]-2-(trifluoromethylsulfonyl)benzoic acid (PubChem CID 67118145) has the molecular formula C32H24Cl2F3N3O5S and a molecular weight of 690.53 g/mol. Its IUPAC name is 3-amino-4-[4-[4-[[4-(2,4-dichlorophenyl)-1-ethylimidazol-2-yl]methyl]phenyl]phenoxy]-2-(trifluoromethylsulfonyl)benzoic acid.
| Compound Name | 3-amino-4-[4-[4-[[4-(2,4-dichlorophenyl)-1-ethylimidazol-2-yl]methyl]phenyl]phenoxy]-2-(trifluoromethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 67118145 |
| Molecular Formula | C32H24Cl2F3N3O5S |
| Molecular Weight | 690.53 g/mol |
| Exact Mass | 689.08 |
| IUPAC Name | 3-amino-4-[4-[4-[[4-(2,4-dichlorophenyl)-1-ethylimidazol-2-yl]methyl]phenyl]phenoxy]-2-(trifluoromethylsulfonyl)benzoic acid |
| SMILES | CCn1cc(-c2ccc(Cl)cc2Cl)nc1Cc1ccc(-c2ccc(Oc3ccc(C(=O)O)c(S(=O)(=O)C(F)(F)F)c3N)cc2)cc1 |
| InChI | InChI=1S/C32H24Cl2F3N3O5S/c1-2-40-17-26(23-12-9-21(33)16-25(23)34)39-28(40)15-18-3-5-19(6-4-18)20-7-10-22(11-8-20)45-27-14-13-24(31(41)42)30(29(27)38)46(43,44)32(35,36)37/h3-14,16-17H,2,15,38H2,1H3,(H,41,42) |
| InChIKey | OIKQTTATZCRJAY-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.53 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|