C38H31Cl2N3O5S — CID 67117891
2-amino-3-benzylsulfonyl-4-[4-[4-[[4-(2,4-dichlorophenyl)-1-ethylimidazol-2-yl]methyl]phenyl]phenoxy]benzoic acid (PubChem CID 67117891) has the molecular formula C38H31Cl2N3O5S and a molecular weight of 712.66 g/mol. Its IUPAC name is 2-amino-3-benzylsulfonyl-4-[4-[4-[[4-(2,4-dichlorophenyl)-1-ethylimidazol-2-yl]methyl]phenyl]phenoxy]benzoic acid.
| Compound Name | 2-amino-3-benzylsulfonyl-4-[4-[4-[[4-(2,4-dichlorophenyl)-1-ethylimidazol-2-yl]methyl]phenyl]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 67117891 |
| Molecular Formula | C38H31Cl2N3O5S |
| Molecular Weight | 712.66 g/mol |
| Exact Mass | 711.14 |
| IUPAC Name | 2-amino-3-benzylsulfonyl-4-[4-[4-[[4-(2,4-dichlorophenyl)-1-ethylimidazol-2-yl]methyl]phenyl]phenoxy]benzoic acid |
| SMILES | CCn1cc(-c2ccc(Cl)cc2Cl)nc1Cc1ccc(-c2ccc(Oc3ccc(C(=O)O)c(N)c3S(=O)(=O)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C38H31Cl2N3O5S/c1-2-43-22-33(30-17-14-28(39)21-32(30)40)42-35(43)20-24-8-10-26(11-9-24)27-12-15-29(16-13-27)48-34-19-18-31(38(44)45)36(41)37(34)49(46,47)23-25-6-4-3-5-7-25/h3-19,21-22H,2,20,23,41H2,1H3,(H,44,45) |
| InChIKey | CPGPMUGJYWNTAG-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.66 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|