C15H17BrF3NO3 — CID 141121389
ethyl 4-acetamido-2-bromo-2-[4-(trifluoromethyl)phenyl]butanoate (PubChem CID 141121389) has the molecular formula C15H17BrF3NO3 and a molecular weight of 396.20 g/mol. Its IUPAC name is ethyl 4-acetamido-2-bromo-2-[4-(trifluoromethyl)phenyl]butanoate.
| Compound Name | ethyl 4-acetamido-2-bromo-2-[4-(trifluoromethyl)phenyl]butanoate |
|---|---|
| PubChem CID | 141121389 |
| Molecular Formula | C15H17BrF3NO3 |
| Molecular Weight | 396.20 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | ethyl 4-acetamido-2-bromo-2-[4-(trifluoromethyl)phenyl]butanoate |
| SMILES | CCOC(=O)C(Br)(CCNC(C)=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H17BrF3NO3/c1-3-23-13(22)14(16,8-9-20-10(2)21)11-4-6-12(7-5-11)15(17,18)19/h4-7H,3,8-9H2,1-2H3,(H,20,21) |
| InChIKey | GAQIRPUGYDRBEN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|