C25H29F3N2O — CID 141121609
[5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-6H-naphthalen-2-yl]methanamine (PubChem CID 141121609) has the molecular formula C25H29F3N2O and a molecular weight of 430.51 g/mol. Its IUPAC name is [5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-6H-naphthalen-2-yl]methanamine.
| Compound Name | [5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-6H-naphthalen-2-yl]methanamine |
|---|---|
| PubChem CID | 141121609 |
| Molecular Formula | C25H29F3N2O |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | [5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-6H-naphthalen-2-yl]methanamine |
| SMILES | NCc1ccc2c(c1)CCCC2=NOCc1ccc(C2CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H29F3N2O/c26-25(27,28)23-14-18(10-11-21(23)19-5-2-1-3-6-19)16-31-30-24-8-4-7-20-13-17(15-29)9-12-22(20)24/h9-14,19H,1-8,15-16,29H2 |
| InChIKey | BXUMIPMODVWBQQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|