C10H11N5 — CID 141122439
indolizine-1,2-dicarboximidamide (PubChem CID 141122439) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is indolizine-1,2-dicarboximidamide.
| Compound Name | indolizine-1,2-dicarboximidamide |
|---|---|
| PubChem CID | 141122439 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | indolizine-1,2-dicarboximidamide |
| SMILES | [H]/N=C(\N)c1cn2ccccc2c1/C(N)=N/[H] |
| InChI | InChI=1S/C10H11N5/c11-9(12)6-5-15-4-2-1-3-7(15)8(6)10(13)14/h1-5H,(H3,11,12)(H3,13,14) |
| InChIKey | WXURHOWHRNVZPO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|