C8H6ClNO2 — CID 141123599
3-chloro-3,4-dihydropyrano[3,4-c]pyridin-1-one (PubChem CID 141123599) has the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. Its IUPAC name is 3-chloro-3,4-dihydropyrano[3,4-c]pyridin-1-one.
| Compound Name | 3-chloro-3,4-dihydropyrano[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 141123599 |
| Molecular Formula | C8H6ClNO2 |
| Molecular Weight | 183.59 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | 3-chloro-3,4-dihydropyrano[3,4-c]pyridin-1-one |
| SMILES | O=C1OC(Cl)Cc2ccncc21 |
| InChI | InChI=1S/C8H6ClNO2/c9-7-3-5-1-2-10-4-6(5)8(11)12-7/h1-2,4,7H,3H2 |
| InChIKey | UAOALWBSCMVMPD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.59 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|