C13H12N2OS — CID 141124782
4-(1H-indol-4-yloxymethyl)-2-methyl-1,3-thiazole (PubChem CID 141124782) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is 4-(1H-indol-4-yloxymethyl)-2-methyl-1,3-thiazole.
| Compound Name | 4-(1H-indol-4-yloxymethyl)-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 141124782 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 4-(1H-indol-4-yloxymethyl)-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(COc2cccc3[nH]ccc23)cs1 |
| InChI | InChI=1S/C13H12N2OS/c1-9-15-10(8-17-9)7-16-13-4-2-3-12-11(13)5-6-14-12/h2-6,8,14H,7H2,1H3 |
| InChIKey | KEIVPDBFYXKDQJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |