C17H15NO2S — CID 23042161
2-methyl-4-[(2-phenoxyphenoxy)methyl]-1,3-thiazole (PubChem CID 23042161) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-methyl-4-[(2-phenoxyphenoxy)methyl]-1,3-thiazole.
| Compound Name | 2-methyl-4-[(2-phenoxyphenoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 23042161 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-methyl-4-[(2-phenoxyphenoxy)methyl]-1,3-thiazole |
| SMILES | Cc1nc(COc2ccccc2Oc2ccccc2)cs1 |
| InChI | InChI=1S/C17H15NO2S/c1-13-18-14(12-21-13)11-19-16-9-5-6-10-17(16)20-15-7-3-2-4-8-15/h2-10,12H,11H2,1H3 |
| InChIKey | SACGTFUSDZLCGZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |