C17H16N2OS — CID 60688412
N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-phenoxyaniline (PubChem CID 60688412) has the molecular formula C17H16N2OS and a molecular weight of 296.40 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-phenoxyaniline.
| Compound Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-phenoxyaniline |
|---|---|
| PubChem CID | 60688412 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-phenoxyaniline |
| SMILES | Cc1nc(CNc2cccc(Oc3ccccc3)c2)cs1 |
| InChI | InChI=1S/C17H16N2OS/c1-13-19-15(12-21-13)11-18-14-6-5-9-17(10-14)20-16-7-3-2-4-8-16/h2-10,12,18H,11H2,1H3 |
| InChIKey | LRWMGQPBFJFNPB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |