C12H15N3O — CID 141124843
2,3,3a,4,5,5a-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide (PubChem CID 141124843) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2,3,3a,4,5,5a-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide.
| Compound Name | 2,3,3a,4,5,5a-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 141124843 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2,3,3a,4,5,5a-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide |
| SMILES | NC(=O)C1=CC2=C3NCCC3CNC2C=C1 |
| InChI | InChI=1S/C12H15N3O/c13-12(16)7-1-2-10-9(5-7)11-8(6-15-10)3-4-14-11/h1-2,5,8,10,14-15H,3-4,6H2,(H2,13,16) |
| InChIKey | LABBSDBXRZDDBA-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |