C14H15NO4S2 — CID 141124885
2-[[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]sulfonyl]acetic acid (PubChem CID 141124885) has the molecular formula C14H15NO4S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]sulfonyl]acetic acid.
| Compound Name | 2-[[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]sulfonyl]acetic acid |
|---|---|
| PubChem CID | 141124885 |
| Molecular Formula | C14H15NO4S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 2-[[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]sulfonyl]acetic acid |
| SMILES | CC(C)c1ccc(-c2csc(S(=O)(=O)CC(=O)O)n2)cc1 |
| InChI | InChI=1S/C14H15NO4S2/c1-9(2)10-3-5-11(6-4-10)12-7-20-14(15-12)21(18,19)8-13(16)17/h3-7,9H,8H2,1-2H3,(H,16,17) |
| InChIKey | YHTWDKWSXQKEIE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |