C23H24O9 — CID 141125304
2,5-dimethoxy-3-phenyl-7-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one (PubChem CID 141125304) has the molecular formula C23H24O9 and a molecular weight of 444.44 g/mol. Its IUPAC name is 2,5-dimethoxy-3-phenyl-7-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one.
| Compound Name | 2,5-dimethoxy-3-phenyl-7-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
|---|---|
| PubChem CID | 141125304 |
| Molecular Formula | C23H24O9 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 2,5-dimethoxy-3-phenyl-7-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
| SMILES | COc1oc2cc(C3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(OC)c2c(=O)c1-c1ccccc1 |
| InChI | InChI=1S/C23H24O9/c1-29-13-8-12(22-21(28)20(27)18(25)15(10-24)31-22)9-14-17(13)19(26)16(23(30-2)32-14)11-6-4-3-5-7-11/h3-9,15,18,20-22,24-25,27-28H,10H2,1-2H3/t15-,18-,20+,21-,22?/m1/s1 |
| InChIKey | JDHWOHHBYKJHHE-WUAVPHCGSA-N |
| XLogP | 0.99 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |