C25H34F2OSi — CID 141125794
2,2-dimethylpropyl-[3-[5-fluoro-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]propoxy]-dimethylsilane (PubChem CID 141125794) has the molecular formula C25H34F2OSi and a molecular weight of 416.63 g/mol. Its IUPAC name is 2,2-dimethylpropyl-[3-[5-fluoro-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]propoxy]-dimethylsilane.
| Compound Name | 2,2-dimethylpropyl-[3-[5-fluoro-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 141125794 |
| Molecular Formula | C25H34F2OSi |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 2,2-dimethylpropyl-[3-[5-fluoro-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]propoxy]-dimethylsilane |
| SMILES | CC(C)(C)C[Si](C)(C)OCCCC1(c2ccc(F)cc2)CCc2cc(F)ccc21 |
| InChI | InChI=1S/C25H34F2OSi/c1-24(2,3)18-29(4,5)28-16-6-14-25(20-7-9-21(26)10-8-20)15-13-19-17-22(27)11-12-23(19)25/h7-12,17H,6,13-16,18H2,1-5H3 |
| InChIKey | BNDDFDKLDNKRMN-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|