C24H19F4N — CID 141126920
1-[1-(3-fluorophenyl)propyl]-3-[3-(trifluoromethyl)phenyl]indole (PubChem CID 141126920) has the molecular formula C24H19F4N and a molecular weight of 397.42 g/mol. Its IUPAC name is 1-[1-(3-fluorophenyl)propyl]-3-[3-(trifluoromethyl)phenyl]indole.
| Compound Name | 1-[1-(3-fluorophenyl)propyl]-3-[3-(trifluoromethyl)phenyl]indole |
|---|---|
| PubChem CID | 141126920 |
| Molecular Formula | C24H19F4N |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 1-[1-(3-fluorophenyl)propyl]-3-[3-(trifluoromethyl)phenyl]indole |
| SMILES | CCC(c1cccc(F)c1)n1cc(-c2cccc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C24H19F4N/c1-2-22(17-8-6-10-19(25)14-17)29-15-21(20-11-3-4-12-23(20)29)16-7-5-9-18(13-16)24(26,27)28/h3-15,22H,2H2,1H3 |
| InChIKey | UICOKZLZILHREL-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |