C25H22F4N2 — CID 141126993
3-(3-fluorophenyl)-N-methyl-3-[3-[3-(trifluoromethyl)phenyl]indol-1-yl]propan-1-amine (PubChem CID 141126993) has the molecular formula C25H22F4N2 and a molecular weight of 426.46 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-methyl-3-[3-[3-(trifluoromethyl)phenyl]indol-1-yl]propan-1-amine.
| Compound Name | 3-(3-fluorophenyl)-N-methyl-3-[3-[3-(trifluoromethyl)phenyl]indol-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 141126993 |
| Molecular Formula | C25H22F4N2 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 3-(3-fluorophenyl)-N-methyl-3-[3-[3-(trifluoromethyl)phenyl]indol-1-yl]propan-1-amine |
| SMILES | CNCCC(c1cccc(F)c1)n1cc(-c2cccc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C25H22F4N2/c1-30-13-12-23(18-7-5-9-20(26)15-18)31-16-22(21-10-2-3-11-24(21)31)17-6-4-8-19(14-17)25(27,28)29/h2-11,14-16,23,30H,12-13H2,1H3 |
| InChIKey | WSVSLZGDGIBPOU-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |