C11H8BrF3O — CID 141127445
1-bromo-5-(trifluoromethyl)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (PubChem CID 141127445) has the molecular formula C11H8BrF3O and a molecular weight of 293.08 g/mol. Its IUPAC name is 1-bromo-5-(trifluoromethyl)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
| Compound Name | 1-bromo-5-(trifluoromethyl)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 141127445 |
| Molecular Formula | C11H8BrF3O |
| Molecular Weight | 293.08 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 1-bromo-5-(trifluoromethyl)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
| SMILES | FC(F)(F)c1ccc2c(c1)C1CCC2(Br)O1 |
| InChI | InChI=1S/C11H8BrF3O/c12-10-4-3-9(16-10)7-5-6(11(13,14)15)1-2-8(7)10/h1-2,5,9H,3-4H2 |
| InChIKey | XQCBENVIBZZRLR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.08 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|