C26H28F3NO — CID 141128296
2-(4-tert-butylphenyl)-5-(5,5,5-trifluoro-1-phenylpentoxy)pyridine (PubChem CID 141128296) has the molecular formula C26H28F3NO and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-5-(5,5,5-trifluoro-1-phenylpentoxy)pyridine.
| Compound Name | 2-(4-tert-butylphenyl)-5-(5,5,5-trifluoro-1-phenylpentoxy)pyridine |
|---|---|
| PubChem CID | 141128296 |
| Molecular Formula | C26H28F3NO |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-(4-tert-butylphenyl)-5-(5,5,5-trifluoro-1-phenylpentoxy)pyridine |
| SMILES | CC(C)(C)c1ccc(-c2ccc(OC(CCCC(F)(F)F)c3ccccc3)cn2)cc1 |
| InChI | InChI=1S/C26H28F3NO/c1-25(2,3)21-13-11-19(12-14-21)23-16-15-22(18-30-23)31-24(10-7-17-26(27,28)29)20-8-5-4-6-9-20/h4-6,8-9,11-16,18,24H,7,10,17H2,1-3H3 |
| InChIKey | BAXMYOVDVQOQDC-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |