C16H20N4O2 — CID 141129464
1-[2-(2-oxopiperidin-1-yl)ethyl]-2H-1,5-naphthyridine-3-carboxamide (PubChem CID 141129464) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-[2-(2-oxopiperidin-1-yl)ethyl]-2H-1,5-naphthyridine-3-carboxamide.
| Compound Name | 1-[2-(2-oxopiperidin-1-yl)ethyl]-2H-1,5-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 141129464 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-[2-(2-oxopiperidin-1-yl)ethyl]-2H-1,5-naphthyridine-3-carboxamide |
| SMILES | NC(=O)C1=Cc2ncccc2N(CCN2CCCCC2=O)C1 |
| InChI | InChI=1S/C16H20N4O2/c17-16(22)12-10-13-14(4-3-6-18-13)20(11-12)9-8-19-7-2-1-5-15(19)21/h3-4,6,10H,1-2,5,7-9,11H2,(H2,17,22) |
| InChIKey | DMWVWBLLUBLXFS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |