About 4-amino-3-phenylbutanoic acid
4-amino-3-phenylbutanoic acid (PubChem CID 14113) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-amino-3-phenylbutanoic acid.
Molecular Properties
| Compound Name | 4-amino-3-phenylbutanoic acid |
| PubChem CID | 14113 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-amino-3-phenylbutanoic acid |
| SMILES | NCC(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C10H13NO2/c11-7-9(6-10(12)13)8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13) |
| InChIKey | DAFOCGYVTAOKAJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-3-phenylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-phenylbutanoic acid?
The IUPAC name of 4-amino-3-phenylbutanoic acid (CID 14113) is 4-amino-3-phenylbutanoic acid.
What is the SMILES notation for 4-amino-3-phenylbutanoic acid?
The canonical SMILES for 4-amino-3-phenylbutanoic acid is NCC(CC(=O)O)c1ccccc1.
What is the InChIKey of 4-amino-3-phenylbutanoic acid?
The InChIKey is DAFOCGYVTAOKAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c11-7-9(6-10(12)13)8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13).
What are the key properties of 4-amino-3-phenylbutanoic acid?
4-amino-3-phenylbutanoic acid has a molecular weight of 179.22 g/mol, XLogP of 1.20, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-phenylbutanoic acid is sourced from PubChem (CID 14113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).