About Arbaclofen
Arbaclofen (PubChem CID 44602) has the molecular formula C10H12ClNO2
and a molecular weight of 213.66 g/mol. Its IUPAC name is (3R)-4-amino-3-(4-chlorophenyl)butanoic acid.
Molecular Properties
| Compound Name | Arbaclofen |
| PubChem CID | 44602 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (3R)-4-amino-3-(4-chlorophenyl)butanoic acid |
| SMILES | C1=CC(=CC=C1[C@@H](CC(=O)O)CN)Cl |
| InChI | InChI=1S/C10H12ClNO2/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8H,5-6,12H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | KPYSYYIEGFHWSV-QMMMGPOBSA-N |
| XLogP | -1.00 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 191 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Arbaclofen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Arbaclofen?
The IUPAC name of Arbaclofen (CID 44602) is (3R)-4-amino-3-(4-chlorophenyl)butanoic acid.
What is the SMILES notation for Arbaclofen?
The canonical SMILES for Arbaclofen is C1=CC(=CC=C1[C@@H](CC(=O)O)CN)Cl.
What is the InChIKey of Arbaclofen?
The InChIKey is KPYSYYIEGFHWSV-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H12ClNO2/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8H,5-6,12H2,(H,13,14)/t8-/m0/s1.
What are the key properties of Arbaclofen?
Arbaclofen has a molecular weight of 213.66 g/mol, XLogP of -1.00, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Arbaclofen is sourced from PubChem (CID 44602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).