About (S)-Baclofen
(S)-Baclofen (PubChem CID 44600) has the molecular formula C10H12ClNO2
and a molecular weight of 213.66 g/mol. Its IUPAC name is (3S)-4-amino-3-(4-chlorophenyl)butanoic acid.
Molecular Properties
| Compound Name | (S)-Baclofen |
| PubChem CID | 44600 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (3S)-4-amino-3-(4-chlorophenyl)butanoic acid |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)CN)Cl |
| InChI | InChI=1S/C10H12ClNO2/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8H,5-6,12H2,(H,13,14)/t8-/m1/s1 |
| InChIKey | KPYSYYIEGFHWSV-MRVPVSSYSA-N |
| XLogP | -1.00 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 191 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (S)-Baclofen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-Baclofen?
The IUPAC name of (S)-Baclofen (CID 44600) is (3S)-4-amino-3-(4-chlorophenyl)butanoic acid.
What is the SMILES notation for (S)-Baclofen?
The canonical SMILES for (S)-Baclofen is C1=CC(=CC=C1[C@H](CC(=O)O)CN)Cl.
What is the InChIKey of (S)-Baclofen?
The InChIKey is KPYSYYIEGFHWSV-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H12ClNO2/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8H,5-6,12H2,(H,13,14)/t8-/m1/s1.
What are the key properties of (S)-Baclofen?
(S)-Baclofen has a molecular weight of 213.66 g/mol, XLogP of -1.00, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-Baclofen is sourced from PubChem (CID 44600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).