C13H9N3O2S — CID 14113060
3-amino-6-pyridin-3-ylthieno[2,3-b]pyridine-2-carboxylic acid (PubChem CID 14113060) has the molecular formula C13H9N3O2S and a molecular weight of 271.30 g/mol. Its IUPAC name is 3-amino-6-pyridin-3-ylthieno[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 3-amino-6-pyridin-3-ylthieno[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 14113060 |
| Molecular Formula | C13H9N3O2S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 3-amino-6-pyridin-3-ylthieno[2,3-b]pyridine-2-carboxylic acid |
| SMILES | Nc1c(C(=O)O)sc2nc(-c3cccnc3)ccc12 |
| InChI | InChI=1S/C13H9N3O2S/c14-10-8-3-4-9(7-2-1-5-15-6-7)16-12(8)19-11(10)13(17)18/h1-6H,14H2,(H,17,18) |
| InChIKey | SRSCSSIGRQPQRV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |