C20H15N3O2S — CID 1009034
benzyl 3-amino-6-pyridin-3-ylthieno[2,3-b]pyridine-2-carboxylate (PubChem CID 1009034) has the molecular formula C20H15N3O2S and a molecular weight of 361.43 g/mol. Its IUPAC name is benzyl 3-amino-6-pyridin-3-ylthieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | benzyl 3-amino-6-pyridin-3-ylthieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 1009034 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | benzyl 3-amino-6-pyridin-3-ylthieno[2,3-b]pyridine-2-carboxylate |
| SMILES | Nc1c(C(=O)OCc2ccccc2)sc2nc(-c3cccnc3)ccc12 |
| InChI | InChI=1S/C20H15N3O2S/c21-17-15-8-9-16(14-7-4-10-22-11-14)23-19(15)26-18(17)20(24)25-12-13-5-2-1-3-6-13/h1-11H,12,21H2 |
| InChIKey | ZFYQISICQHEUPA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |