C10H7F4NO3 — CID 141131515
[(2-fluorobenzoyl)-methylamino] 2,2,2-trifluoroacetate (PubChem CID 141131515) has the molecular formula C10H7F4NO3 and a molecular weight of 265.16 g/mol. Its IUPAC name is [(2-fluorobenzoyl)-methylamino] 2,2,2-trifluoroacetate.
| Compound Name | [(2-fluorobenzoyl)-methylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 141131515 |
| Molecular Formula | C10H7F4NO3 |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | [(2-fluorobenzoyl)-methylamino] 2,2,2-trifluoroacetate |
| SMILES | CN(OC(=O)C(F)(F)F)C(=O)c1ccccc1F |
| InChI | InChI=1S/C10H7F4NO3/c1-15(18-9(17)10(12,13)14)8(16)6-4-2-3-5-7(6)11/h2-5H,1H3 |
| InChIKey | XVDOOCSJAUYJRM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|