C24H24O4 — CID 141133194
2-[2-[1,3-bis(furan-2-yl)propan-2-yl]-4-(furan-2-yl)-3-methylbut-2-enyl]furan (PubChem CID 141133194) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-[2-[1,3-bis(furan-2-yl)propan-2-yl]-4-(furan-2-yl)-3-methylbut-2-enyl]furan.
| Compound Name | 2-[2-[1,3-bis(furan-2-yl)propan-2-yl]-4-(furan-2-yl)-3-methylbut-2-enyl]furan |
|---|---|
| PubChem CID | 141133194 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-[2-[1,3-bis(furan-2-yl)propan-2-yl]-4-(furan-2-yl)-3-methylbut-2-enyl]furan |
| SMILES | CC(Cc1ccco1)=C(Cc1ccco1)C(Cc1ccco1)Cc1ccco1 |
| InChI | InChI=1S/C24H24O4/c1-18(14-20-6-2-10-25-20)24(17-23-9-5-13-28-23)19(15-21-7-3-11-26-21)16-22-8-4-12-27-22/h2-13,19H,14-17H2,1H3 |
| InChIKey | UBFDMVZYULOARR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 52.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|