C13H24O3Si — CID 141134647
2-(3-triethylsilyloxycyclopenten-1-yl)acetic acid (PubChem CID 141134647) has the molecular formula C13H24O3Si and a molecular weight of 256.42 g/mol. Its IUPAC name is 2-(3-triethylsilyloxycyclopenten-1-yl)acetic acid.
| Compound Name | 2-(3-triethylsilyloxycyclopenten-1-yl)acetic acid |
|---|---|
| PubChem CID | 141134647 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-(3-triethylsilyloxycyclopenten-1-yl)acetic acid |
| SMILES | CC[Si](CC)(CC)OC1C=C(CC(=O)O)CC1 |
| InChI | InChI=1S/C13H24O3Si/c1-4-17(5-2,6-3)16-12-8-7-11(9-12)10-13(14)15/h9,12H,4-8,10H2,1-3H3,(H,14,15) |
| InChIKey | NICBUSMITPHTIA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|