C21H41N7O — CID 141134793
4-(2-piperazin-1-yl-2-piperidin-1-yl-3-pyrrolidin-1-ylpiperazin-1-yl)morpholine (PubChem CID 141134793) has the molecular formula C21H41N7O and a molecular weight of 407.61 g/mol. Its IUPAC name is 4-(2-piperazin-1-yl-2-piperidin-1-yl-3-pyrrolidin-1-ylpiperazin-1-yl)morpholine.
| Compound Name | 4-(2-piperazin-1-yl-2-piperidin-1-yl-3-pyrrolidin-1-ylpiperazin-1-yl)morpholine |
|---|---|
| PubChem CID | 141134793 |
| Molecular Formula | C21H41N7O |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.34 |
| IUPAC Name | 4-(2-piperazin-1-yl-2-piperidin-1-yl-3-pyrrolidin-1-ylpiperazin-1-yl)morpholine |
| SMILES | C1CCN(C2(N3CCNCC3)C(N3CCCC3)NCCN2N2CCOCC2)CC1 |
| InChI | InChI=1S/C21H41N7O/c1-2-11-25(12-3-1)21(26-13-6-22-7-14-26)20(24-9-4-5-10-24)23-8-15-28(21)27-16-18-29-19-17-27/h20,22-23H,1-19H2 |
| InChIKey | DNPZYCBYXVTLDD-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |