C27H28N2S — CID 141136451
3-[1,5-bis(4-methylphenyl)pyrazol-3-yl]-2-(3-methylphenyl)propane-1-thiol (PubChem CID 141136451) has the molecular formula C27H28N2S and a molecular weight of 412.60 g/mol. Its IUPAC name is 3-[1,5-bis(4-methylphenyl)pyrazol-3-yl]-2-(3-methylphenyl)propane-1-thiol.
| Compound Name | 3-[1,5-bis(4-methylphenyl)pyrazol-3-yl]-2-(3-methylphenyl)propane-1-thiol |
|---|---|
| PubChem CID | 141136451 |
| Molecular Formula | C27H28N2S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 3-[1,5-bis(4-methylphenyl)pyrazol-3-yl]-2-(3-methylphenyl)propane-1-thiol |
| SMILES | Cc1ccc(-c2cc(CC(CS)c3cccc(C)c3)nn2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H28N2S/c1-19-7-11-22(12-8-19)27-17-25(28-29(27)26-13-9-20(2)10-14-26)16-24(18-30)23-6-4-5-21(3)15-23/h4-15,17,24,30H,16,18H2,1-3H3 |
| InChIKey | DDEFWVRQVHUGGG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|