C9H16N2O2S — CID 141137162
N-(oxan-2-yl)-1,3-thiazolidine-3-carboxamide (PubChem CID 141137162) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is N-(oxan-2-yl)-1,3-thiazolidine-3-carboxamide.
| Compound Name | N-(oxan-2-yl)-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 141137162 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | N-(oxan-2-yl)-1,3-thiazolidine-3-carboxamide |
| SMILES | O=C(NC1CCCCO1)N1CCSC1 |
| InChI | InChI=1S/C9H16N2O2S/c12-9(11-4-6-14-7-11)10-8-3-1-2-5-13-8/h8H,1-7H2,(H,10,12) |
| InChIKey | CZZPMWVZRAXHOK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |