C19H15F3N8O — CID 141138589
1-[4-(5-aminoimidazol-1-yl)phenyl]-3-[2-(triazol-1-yl)-5-(trifluoromethyl)phenyl]urea (PubChem CID 141138589) has the molecular formula C19H15F3N8O and a molecular weight of 428.38 g/mol. Its IUPAC name is 1-[4-(5-aminoimidazol-1-yl)phenyl]-3-[2-(triazol-1-yl)-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(5-aminoimidazol-1-yl)phenyl]-3-[2-(triazol-1-yl)-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 141138589 |
| Molecular Formula | C19H15F3N8O |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 1-[4-(5-aminoimidazol-1-yl)phenyl]-3-[2-(triazol-1-yl)-5-(trifluoromethyl)phenyl]urea |
| SMILES | Nc1cncn1-c1ccc(NC(=O)Nc2cc(C(F)(F)F)ccc2-n2ccnn2)cc1 |
| InChI | InChI=1S/C19H15F3N8O/c20-19(21,22)12-1-6-16(30-8-7-25-28-30)15(9-12)27-18(31)26-13-2-4-14(5-3-13)29-11-24-10-17(29)23/h1-11H,23H2,(H2,26,27,31) |
| InChIKey | VXZMCRNDSCDMOF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |