C22H25BrO6 — CID 141140358
ethyl 3-[2-bromo-4-[(4-ethoxyphenyl)methoxy]-3,5-dimethoxyphenyl]prop-2-enoate (PubChem CID 141140358) has the molecular formula C22H25BrO6 and a molecular weight of 465.34 g/mol. Its IUPAC name is ethyl 3-[2-bromo-4-[(4-ethoxyphenyl)methoxy]-3,5-dimethoxyphenyl]prop-2-enoate.
| Compound Name | ethyl 3-[2-bromo-4-[(4-ethoxyphenyl)methoxy]-3,5-dimethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 141140358 |
| Molecular Formula | C22H25BrO6 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | ethyl 3-[2-bromo-4-[(4-ethoxyphenyl)methoxy]-3,5-dimethoxyphenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cc(OC)c(OCc2ccc(OCC)cc2)c(OC)c1Br |
| InChI | InChI=1S/C22H25BrO6/c1-5-27-17-10-7-15(8-11-17)14-29-21-18(25-3)13-16(20(23)22(21)26-4)9-12-19(24)28-6-2/h7-13H,5-6,14H2,1-4H3 |
| InChIKey | FUMWXMVQTGVJFM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|