C21H24O7 — CID 141140361
3-[4-[(4-ethoxyphenyl)methoxy]-2,3,5-trimethoxyphenyl]prop-2-enoic acid (PubChem CID 141140361) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is 3-[4-[(4-ethoxyphenyl)methoxy]-2,3,5-trimethoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(4-ethoxyphenyl)methoxy]-2,3,5-trimethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 141140361 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3-[4-[(4-ethoxyphenyl)methoxy]-2,3,5-trimethoxyphenyl]prop-2-enoic acid |
| SMILES | CCOc1ccc(COc2c(OC)cc(C=CC(=O)O)c(OC)c2OC)cc1 |
| InChI | InChI=1S/C21H24O7/c1-5-27-16-9-6-14(7-10-16)13-28-20-17(24-2)12-15(8-11-18(22)23)19(25-3)21(20)26-4/h6-12H,5,13H2,1-4H3,(H,22,23) |
| InChIKey | RVAZLUIFZPAXPW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|