C22H24O8 — CID 91163729
2-[6-(2-carboxyethenyl)-2-[(3,4-dimethoxyphenyl)methoxy]-3-methoxyphenyl]propanoic acid (PubChem CID 91163729) has the molecular formula C22H24O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is 2-[6-(2-carboxyethenyl)-2-[(3,4-dimethoxyphenyl)methoxy]-3-methoxyphenyl]propanoic acid.
| Compound Name | 2-[6-(2-carboxyethenyl)-2-[(3,4-dimethoxyphenyl)methoxy]-3-methoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 91163729 |
| Molecular Formula | C22H24O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-[6-(2-carboxyethenyl)-2-[(3,4-dimethoxyphenyl)methoxy]-3-methoxyphenyl]propanoic acid |
| SMILES | COc1ccc(COc2c(OC)ccc(C=CC(=O)O)c2C(C)C(=O)O)cc1OC |
| InChI | InChI=1S/C22H24O8/c1-13(22(25)26)20-15(7-10-19(23)24)6-9-17(28-3)21(20)30-12-14-5-8-16(27-2)18(11-14)29-4/h5-11,13H,12H2,1-4H3,(H,23,24)(H,25,26) |
| InChIKey | JNHHWWKXKJWLTR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|