C24H28O4 — CID 147754129
(E)-3-[2-[(4-ethylphenyl)methoxy]-4-methoxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid (PubChem CID 147754129) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is (E)-3-[2-[(4-ethylphenyl)methoxy]-4-methoxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[(4-ethylphenyl)methoxy]-4-methoxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 147754129 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (E)-3-[2-[(4-ethylphenyl)methoxy]-4-methoxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid |
| SMILES | CCc1ccc(COc2c(/C=C/C(=O)O)ccc(OC)c2CC=C(C)C)cc1 |
| InChI | InChI=1S/C24H28O4/c1-5-18-7-9-19(10-8-18)16-28-24-20(12-15-23(25)26)11-14-22(27-4)21(24)13-6-17(2)3/h6-12,14-15H,5,13,16H2,1-4H3,(H,25,26)/b15-12+ |
| InChIKey | HCTWTLFDBJQFSL-NTCAYCPXSA-N |
| XLogP | 5.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|