C23H26NO5- — CID 59532676
(E)-3-[4-methoxy-2-[(4-methoxyphenyl)methoxy]-3-(3-methylbut-2-enyl)phenyl]-N-oxidoprop-2-enamide (PubChem CID 59532676) has the molecular formula C23H26NO5- and a molecular weight of 396.46 g/mol. Its IUPAC name is (E)-3-[4-methoxy-2-[(4-methoxyphenyl)methoxy]-3-(3-methylbut-2-enyl)phenyl]-N-oxidoprop-2-enamide.
| Compound Name | (E)-3-[4-methoxy-2-[(4-methoxyphenyl)methoxy]-3-(3-methylbut-2-enyl)phenyl]-N-oxidoprop-2-enamide |
|---|---|
| PubChem CID | 59532676 |
| Molecular Formula | C23H26NO5- |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (E)-3-[4-methoxy-2-[(4-methoxyphenyl)methoxy]-3-(3-methylbut-2-enyl)phenyl]-N-oxidoprop-2-enamide |
| SMILES | COc1ccc(COc2c(/C=C/C(=O)N[O-])ccc(OC)c2CC=C(C)C)cc1 |
| InChI | InChI=1S/C23H26NO5/c1-16(2)5-12-20-21(28-4)13-8-18(9-14-22(25)24-26)23(20)29-15-17-6-10-19(27-3)11-7-17/h5-11,13-14H,12,15H2,1-4H3,(H-,24,25,26)/q-1/b14-9+ |
| InChIKey | WORLXSYZAOMKGJ-NTEUORMPSA-N |
| XLogP | 4.42 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|