C23H23F3NO4- — CID 58114384
(E)-3-[4-methyl-3-(3-methylbut-2-enyl)-2-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]-N-oxidoprop-2-enamide (PubChem CID 58114384) has the molecular formula C23H23F3NO4- and a molecular weight of 434.43 g/mol. Its IUPAC name is (E)-3-[4-methyl-3-(3-methylbut-2-enyl)-2-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]-N-oxidoprop-2-enamide.
| Compound Name | (E)-3-[4-methyl-3-(3-methylbut-2-enyl)-2-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]-N-oxidoprop-2-enamide |
|---|---|
| PubChem CID | 58114384 |
| Molecular Formula | C23H23F3NO4- |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (E)-3-[4-methyl-3-(3-methylbut-2-enyl)-2-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]-N-oxidoprop-2-enamide |
| SMILES | CC(C)=CCc1c(C)ccc(/C=C/C(=O)N[O-])c1OCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H23F3NO4/c1-15(2)4-12-20-16(3)5-8-18(9-13-21(28)27-29)22(20)30-14-17-6-10-19(11-7-17)31-23(24,25)26/h4-11,13H,12,14H2,1-3H3,(H-,27,28,29)/q-1/b13-9+ |
| InChIKey | NZZMQOJPLLREJP-UKTHLTGXSA-N |
| XLogP | 5.61 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|