C23H23Cl3NO5- — CID 59532683
(E)-3-[4-methoxy-3-(3-methylbut-2-enyl)-2-[[4-(trichloromethoxy)phenyl]methoxy]phenyl]-N-oxidoprop-2-enamide (PubChem CID 59532683) has the molecular formula C23H23Cl3NO5- and a molecular weight of 499.80 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-(3-methylbut-2-enyl)-2-[[4-(trichloromethoxy)phenyl]methoxy]phenyl]-N-oxidoprop-2-enamide.
| Compound Name | (E)-3-[4-methoxy-3-(3-methylbut-2-enyl)-2-[[4-(trichloromethoxy)phenyl]methoxy]phenyl]-N-oxidoprop-2-enamide |
|---|---|
| PubChem CID | 59532683 |
| Molecular Formula | C23H23Cl3NO5- |
| Molecular Weight | 499.80 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | (E)-3-[4-methoxy-3-(3-methylbut-2-enyl)-2-[[4-(trichloromethoxy)phenyl]methoxy]phenyl]-N-oxidoprop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N[O-])c(OCc2ccc(OC(Cl)(Cl)Cl)cc2)c1CC=C(C)C |
| InChI | InChI=1S/C23H23Cl3NO5/c1-15(2)4-11-19-20(30-3)12-7-17(8-13-21(28)27-29)22(19)31-14-16-5-9-18(10-6-16)32-23(24,25)26/h4-10,12-13H,11,14H2,1-3H3,(H-,27,28,29)/q-1/b13-8+ |
| InChIKey | ZNXJHTJCWQWODF-MDWZMJQESA-N |
| XLogP | 6.12 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.80 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|