C13H9N3O2S — CID 141141772
2-[5-(1,3-benzodioxol-5-yl)pyrazol-1-yl]-1,3-thiazole (PubChem CID 141141772) has the molecular formula C13H9N3O2S and a molecular weight of 271.30 g/mol. Its IUPAC name is 2-[5-(1,3-benzodioxol-5-yl)pyrazol-1-yl]-1,3-thiazole.
| Compound Name | 2-[5-(1,3-benzodioxol-5-yl)pyrazol-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 141141772 |
| Molecular Formula | C13H9N3O2S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-[5-(1,3-benzodioxol-5-yl)pyrazol-1-yl]-1,3-thiazole |
| SMILES | c1csc(-n2nccc2-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C13H9N3O2S/c1-2-11-12(18-8-17-11)7-9(1)10-3-4-15-16(10)13-14-5-6-19-13/h1-7H,8H2 |
| InChIKey | AZZMFTXAIFOWGU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |