C15H10O2S — CID 163567216
5-(1-benzothiophen-5-yl)-1,3-benzodioxole (PubChem CID 163567216) has the molecular formula C15H10O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is 5-(1-benzothiophen-5-yl)-1,3-benzodioxole.
| Compound Name | 5-(1-benzothiophen-5-yl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 163567216 |
| Molecular Formula | C15H10O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-(1-benzothiophen-5-yl)-1,3-benzodioxole |
| SMILES | c1cc2cc(-c3ccc4c(c3)OCO4)ccc2s1 |
| InChI | InChI=1S/C15H10O2S/c1-3-13-14(17-9-16-13)8-11(1)10-2-4-15-12(7-10)5-6-18-15/h1-8H,9H2 |
| InChIKey | FWFQDCRRFBGDEP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |