C20H21FN2O2S — CID 141143392
3-(benzenesulfonyl)-4-fluoro-2-methyl-1-(pyrrolidin-2-ylmethyl)indole (PubChem CID 141143392) has the molecular formula C20H21FN2O2S and a molecular weight of 372.46 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-4-fluoro-2-methyl-1-(pyrrolidin-2-ylmethyl)indole.
| Compound Name | 3-(benzenesulfonyl)-4-fluoro-2-methyl-1-(pyrrolidin-2-ylmethyl)indole |
|---|---|
| PubChem CID | 141143392 |
| Molecular Formula | C20H21FN2O2S |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 3-(benzenesulfonyl)-4-fluoro-2-methyl-1-(pyrrolidin-2-ylmethyl)indole |
| SMILES | Cc1c(S(=O)(=O)c2ccccc2)c2c(F)cccc2n1CC1CCCN1 |
| InChI | InChI=1S/C20H21FN2O2S/c1-14-20(26(24,25)16-8-3-2-4-9-16)19-17(21)10-5-11-18(19)23(14)13-15-7-6-12-22-15/h2-5,8-11,15,22H,6-7,12-13H2,1H3 |
| InChIKey | GMWGMJHJZAOARF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |