C19H24INO4 — CID 141145265
N-iodyl-N-[(2S)-1-(3-methoxyphenoxy)propan-2-yl]-2,4,6-trimethylaniline (PubChem CID 141145265) has the molecular formula C19H24INO4 and a molecular weight of 457.31 g/mol. Its IUPAC name is N-iodyl-N-[(2S)-1-(3-methoxyphenoxy)propan-2-yl]-2,4,6-trimethylaniline.
| Compound Name | N-iodyl-N-[(2S)-1-(3-methoxyphenoxy)propan-2-yl]-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 141145265 |
| Molecular Formula | C19H24INO4 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | N-iodyl-N-[(2S)-1-(3-methoxyphenoxy)propan-2-yl]-2,4,6-trimethylaniline |
| SMILES | COc1cccc(OC[C@H](C)N(c2c(C)cc(C)cc2C)I(=O)=O)c1 |
| InChI | InChI=1S/C19H24INO4/c1-13-9-14(2)19(15(3)10-13)21(20(22)23)16(4)12-25-18-8-6-7-17(11-18)24-5/h6-11,16H,12H2,1-5H3/t16-/m0/s1 |
| InChIKey | XYPKOUAVFOGAFX-INIZCTEOSA-N |
| XLogP | 5.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|