C17H17NO2 — CID 141145466
5-methyl-2-(4-phenylmethoxyphenyl)-3H-1,2-oxazole (PubChem CID 141145466) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 5-methyl-2-(4-phenylmethoxyphenyl)-3H-1,2-oxazole.
| Compound Name | 5-methyl-2-(4-phenylmethoxyphenyl)-3H-1,2-oxazole |
|---|---|
| PubChem CID | 141145466 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 5-methyl-2-(4-phenylmethoxyphenyl)-3H-1,2-oxazole |
| SMILES | CC1=CCN(c2ccc(OCc3ccccc3)cc2)O1 |
| InChI | InChI=1S/C17H17NO2/c1-14-11-12-18(20-14)16-7-9-17(10-8-16)19-13-15-5-3-2-4-6-15/h2-11H,12-13H2,1H3 |
| InChIKey | ROUXGOGMQYRNQK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |