C20H15FN4O — CID 141145750
1-(2-fluorophenyl)-3-[4-(1H-pyrrolo[3,2-b]pyridin-3-yl)phenyl]urea (PubChem CID 141145750) has the molecular formula C20H15FN4O and a molecular weight of 346.37 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[4-(1H-pyrrolo[3,2-b]pyridin-3-yl)phenyl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[4-(1H-pyrrolo[3,2-b]pyridin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 141145750 |
| Molecular Formula | C20H15FN4O |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[4-(1H-pyrrolo[3,2-b]pyridin-3-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2c[nH]c3cccnc23)cc1)Nc1ccccc1F |
| InChI | InChI=1S/C20H15FN4O/c21-16-4-1-2-5-17(16)25-20(26)24-14-9-7-13(8-10-14)15-12-23-18-6-3-11-22-19(15)18/h1-12,23H,(H2,24,25,26) |
| InChIKey | OHZNIRYJLJJBAV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |