C13H10FN3O3 — CID 63651767
4-[(2-fluorophenyl)carbamoylamino]pyridine-2-carboxylic acid (PubChem CID 63651767) has the molecular formula C13H10FN3O3 and a molecular weight of 275.24 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)carbamoylamino]pyridine-2-carboxylic acid.
| Compound Name | 4-[(2-fluorophenyl)carbamoylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 63651767 |
| Molecular Formula | C13H10FN3O3 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 4-[(2-fluorophenyl)carbamoylamino]pyridine-2-carboxylic acid |
| SMILES | O=C(Nc1ccnc(C(=O)O)c1)Nc1ccccc1F |
| InChI | InChI=1S/C13H10FN3O3/c14-9-3-1-2-4-10(9)17-13(20)16-8-5-6-15-11(7-8)12(18)19/h1-7H,(H,18,19)(H2,15,16,17,20) |
| InChIKey | KRALNAPPPPWLNV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |