C14H10N4O3 — CID 63650036
4-[(4-cyanophenyl)carbamoylamino]pyridine-2-carboxylic acid (PubChem CID 63650036) has the molecular formula C14H10N4O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is 4-[(4-cyanophenyl)carbamoylamino]pyridine-2-carboxylic acid.
| Compound Name | 4-[(4-cyanophenyl)carbamoylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 63650036 |
| Molecular Formula | C14H10N4O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-[(4-cyanophenyl)carbamoylamino]pyridine-2-carboxylic acid |
| SMILES | N#Cc1ccc(NC(=O)Nc2ccnc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C14H10N4O3/c15-8-9-1-3-10(4-2-9)17-14(21)18-11-5-6-16-12(7-11)13(19)20/h1-7H,(H,19,20)(H2,16,17,18,21) |
| InChIKey | KPZMOPGOTYORTC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |