4-(4-cyanophenoxy)pyridine-2-carboxylic acid

C13H8N2O3 — CID 43142929

IUPAC4-(4-cyanophenoxy)pyridine-2-carboxylic acid
SMILESN#Cc1ccc(Oc2ccnc(C(=O)O)c2)cc1
InChIInChI=1S/C13H8N2O3/c14-8-9-1-3-10(4-2-9)18-11-5-6-15-12(7-11)13(16)17/h1-7H,(H,16,17)
InChIKeyJVDWGFIBDSYARB-UHFFFAOYSA-N
MW240.22 g/mol
LogP2.44
Rot. Bonds3

About 4-(4-cyanophenoxy)pyridine-2-carboxylic acid

4-(4-cyanophenoxy)pyridine-2-carboxylic acid (PubChem CID 43142929) has the molecular formula C13H8N2O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is 4-(4-cyanophenoxy)pyridine-2-carboxylic acid.

Molecular Properties

Compound Name4-(4-cyanophenoxy)pyridine-2-carboxylic acid
PubChem CID43142929
Molecular FormulaC13H8N2O3
Molecular Weight240.22 g/mol
Exact Mass240.05
IUPAC Name4-(4-cyanophenoxy)pyridine-2-carboxylic acid
SMILESN#Cc1ccc(Oc2ccnc(C(=O)O)c2)cc1
InChIInChI=1S/C13H8N2O3/c14-8-9-1-3-10(4-2-9)18-11-5-6-15-12(7-11)13(16)17/h1-7H,(H,16,17)
InChIKeyJVDWGFIBDSYARB-UHFFFAOYSA-N
XLogP2.44
TPSA83.21 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.22
LogP ≤ 52.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(4-cyanophenoxy)pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-(4-hydroxyphenoxy)pyridine-2-carboxylic acid
CID 69017649
4-(4-cyano-2-methoxyphenoxy)pyridine-2-carboxylic acid
CID 43325992
4-[4-[4-[5-(4-phenylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]phenoxy]pyridine-2-carboxylic acid
CID 140746647
4-(2,3-dihydro-1H-inden-5-yloxy)pyridine-2-carboxylic acid
CID 43326034
4-[[2-(methylamino)-4-pyridinyl]oxy]benzonitrile
CID 113368098
4-[(4-cyanophenyl)carbamoylamino]pyridine-2-carboxylic acid
CID 63650036
4-(4-imidazol-1-ylphenoxy)pyridine-2-carboxylic acid
CID 67405266
4-[4-fluoro-3-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid
CID 102747015
4-[4-[(3-cyanophenyl)carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide
CID 118002070
4-(3-chloro-4-nitrophenoxy)pyridine-2-carboxylic acid
CID 62111596
4-(3-ethylphenoxy)pyridine-2-carboxylic acid
CID 43326028
4-[4-(2,2-dicyanoethenylamino)phenoxy]-N-methylpyridine-2-carboxamide
CID 168541218

Frequently Asked Questions

What is the IUPAC name of 4-(4-cyanophenoxy)pyridine-2-carboxylic acid?
The IUPAC name of 4-(4-cyanophenoxy)pyridine-2-carboxylic acid (CID 43142929) is 4-(4-cyanophenoxy)pyridine-2-carboxylic acid.
What is the SMILES notation for 4-(4-cyanophenoxy)pyridine-2-carboxylic acid?
The canonical SMILES for 4-(4-cyanophenoxy)pyridine-2-carboxylic acid is N#Cc1ccc(Oc2ccnc(C(=O)O)c2)cc1.
What is the InChIKey of 4-(4-cyanophenoxy)pyridine-2-carboxylic acid?
The InChIKey is JVDWGFIBDSYARB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O3/c14-8-9-1-3-10(4-2-9)18-11-5-6-15-12(7-11)13(16)17/h1-7H,(H,16,17).
What are the key properties of 4-(4-cyanophenoxy)pyridine-2-carboxylic acid?
4-(4-cyanophenoxy)pyridine-2-carboxylic acid has a molecular weight of 240.22 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-cyanophenoxy)pyridine-2-carboxylic acid is sourced from PubChem (CID 43142929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).