C19H29NO9 — CID 141148026
[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 4-[bis(3-hydroxypropyl)amino]benzoate (PubChem CID 141148026) has the molecular formula C19H29NO9 and a molecular weight of 415.44 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 4-[bis(3-hydroxypropyl)amino]benzoate.
| Compound Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 4-[bis(3-hydroxypropyl)amino]benzoate |
|---|---|
| PubChem CID | 141148026 |
| Molecular Formula | C19H29NO9 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 4-[bis(3-hydroxypropyl)amino]benzoate |
| SMILES | O=C(OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccc(N(CCCO)CCCO)cc1 |
| InChI | InChI=1S/C19H29NO9/c21-9-1-7-20(8-2-10-22)13-5-3-12(4-6-13)18(27)29-19-17(26)16(25)15(24)14(11-23)28-19/h3-6,14-17,19,21-26H,1-2,7-11H2/t14-,15-,16+,17-,19?/m1/s1 |
| InChIKey | DEHGBSOWCWYJHQ-YPEANGHVSA-N |
| XLogP | -1.79 |
| TPSA | 160.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |