C22H21NO5 — CID 141148539
3-(3-carboxy-9H-xanthen-9-yl)-8-azabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 141148539) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is 3-(3-carboxy-9H-xanthen-9-yl)-8-azabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | 3-(3-carboxy-9H-xanthen-9-yl)-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 141148539 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 3-(3-carboxy-9H-xanthen-9-yl)-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)Oc1ccccc1C2C1CC2CCC(C1)N2C(=O)O |
| InChI | InChI=1S/C22H21NO5/c24-21(25)12-5-8-17-19(11-12)28-18-4-2-1-3-16(18)20(17)13-9-14-6-7-15(10-13)23(14)22(26)27/h1-5,8,11,13-15,20H,6-7,9-10H2,(H,24,25)(H,26,27) |
| InChIKey | LETGGQBEORLTHS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |